About 2,6-dimethylnaphthalene-1,3,8-triamine
2,6-dimethylnaphthalene-1,3,8-triamine (PubChem CID 158818668) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,6-dimethylnaphthalene-1,3,8-triamine.
Molecular Properties
| Compound Name | 2,6-dimethylnaphthalene-1,3,8-triamine |
| PubChem CID | 158818668 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2,6-dimethylnaphthalene-1,3,8-triamine |
| SMILES | Cc1cc(N)c2c(N)c(C)c(N)cc2c1 |
| InChI | InChI=1S/C12H15N3/c1-6-3-8-5-9(13)7(2)12(15)11(8)10(14)4-6/h3-5H,13-15H2,1-2H3 |
| InChIKey | IVOZLLLXIVZRRE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylnaphthalene-1,3,8-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylnaphthalene-1,3,8-triamine?
The IUPAC name of 2,6-dimethylnaphthalene-1,3,8-triamine (CID 158818668) is 2,6-dimethylnaphthalene-1,3,8-triamine.
What is the SMILES notation for 2,6-dimethylnaphthalene-1,3,8-triamine?
The canonical SMILES for 2,6-dimethylnaphthalene-1,3,8-triamine is Cc1cc(N)c2c(N)c(C)c(N)cc2c1.
What is the InChIKey of 2,6-dimethylnaphthalene-1,3,8-triamine?
The InChIKey is IVOZLLLXIVZRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-6-3-8-5-9(13)7(2)12(15)11(8)10(14)4-6/h3-5H,13-15H2,1-2H3.
What are the key properties of 2,6-dimethylnaphthalene-1,3,8-triamine?
2,6-dimethylnaphthalene-1,3,8-triamine has a molecular weight of 201.27 g/mol, XLogP of 2.20, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylnaphthalene-1,3,8-triamine is sourced from PubChem (CID 158818668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).