About 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole
1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole (PubChem CID 158819100) has the molecular formula C17H31N3O
and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole.
Molecular Properties
| Compound Name | 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole |
| PubChem CID | 158819100 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole |
| SMILES | CCC(C)N1CCCCCC1=O.CCC(C)n1ccnc1 |
| InChI | InChI=1S/C10H19NO.C7H12N2/c1-3-9(2)11-8-6-4-5-7-10(11)12;1-3-7(2)9-5-4-8-6-9/h9H,3-8H2,1-2H3;4-7H,3H2,1-2H3 |
| InChIKey | IVQHDOJAEWMCPP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole?
The IUPAC name of 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole (CID 158819100) is 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole.
What is the SMILES notation for 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole?
The canonical SMILES for 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole is CCC(C)N1CCCCCC1=O.CCC(C)n1ccnc1.
What is the InChIKey of 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole?
The InChIKey is IVQHDOJAEWMCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C7H12N2/c1-3-9(2)11-8-6-4-5-7-10(11)12;1-3-7(2)9-5-4-8-6-9/h9H,3-8H2,1-2H3;4-7H,3H2,1-2H3.
What are the key properties of 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole?
1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole has a molecular weight of 293.45 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylazepan-2-one;1-butan-2-ylimidazole is sourced from PubChem (CID 158819100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).