C29H22Cl2F2N4O4 — CID 158819225
dichloromethane;5-fluoro-4-methoxy-1,10-phenanthroline-2-carbaldehyde;(5-fluoro-4-methoxy-1,10-phenanthrolin-2-yl)methanol (PubChem CID 158819225) has the molecular formula C29H22Cl2F2N4O4 and a molecular weight of 599.42 g/mol. Its IUPAC name is dichloromethane;5-fluoro-4-methoxy-1,10-phenanthroline-2-carbaldehyde;(5-fluoro-4-methoxy-1,10-phenanthrolin-2-yl)methanol.
| Compound Name | dichloromethane;5-fluoro-4-methoxy-1,10-phenanthroline-2-carbaldehyde;(5-fluoro-4-methoxy-1,10-phenanthrolin-2-yl)methanol |
|---|---|
| PubChem CID | 158819225 |
| Molecular Formula | C29H22Cl2F2N4O4 |
| Molecular Weight | 599.42 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | dichloromethane;5-fluoro-4-methoxy-1,10-phenanthroline-2-carbaldehyde;(5-fluoro-4-methoxy-1,10-phenanthrolin-2-yl)methanol |
| SMILES | COc1cc(C=O)nc2c1c(F)cc1cccnc12.COc1cc(CO)nc2c1c(F)cc1cccnc12.ClCCl |
| InChI | InChI=1S/C14H11FN2O2.C14H9FN2O2.CH2Cl2/c2*1-19-11-6-9(7-18)17-14-12(11)10(15)5-8-3-2-4-16-13(8)14;2-1-3/h2-6,18H,7H2,1H3;2-7H,1H3;1H2 |
| InChIKey | IVQREDYSTRHVCO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|