C13H13BrN2O2S — CID 158819543
5-bromo-3-(2-phenylethylsulfonyl)pyridin-2-amine (PubChem CID 158819543) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 5-bromo-3-(2-phenylethylsulfonyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-(2-phenylethylsulfonyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158819543 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 5-bromo-3-(2-phenylethylsulfonyl)pyridin-2-amine |
| SMILES | Nc1ncc(Br)cc1S(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C13H13BrN2O2S/c14-11-8-12(13(15)16-9-11)19(17,18)7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H2,15,16) |
| InChIKey | VSKRAQZKKSDTPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |