C43H57N9O2 — CID 158819749
2-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenol;6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol (PubChem CID 158819749) has the molecular formula C43H57N9O2 and a molecular weight of 731.99 g/mol. Its IUPAC name is 2-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenol;6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol.
| Compound Name | 2-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenol;6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol |
|---|---|
| PubChem CID | 158819749 |
| Molecular Formula | C43H57N9O2 |
| Molecular Weight | 731.99 g/mol |
| Exact Mass | 731.46 |
| IUPAC Name | 2-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]phenol;6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol |
| SMILES | CN(c1ccc(-c2cc3cccnc3cc2O)nn1)C1CC(C)(C)NC(C)(C)C1.CN(c1ccc(-c2ccccc2O)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H29N5O.C20H28N4O/c1-22(2)13-16(14-23(3,4)27-22)28(5)21-9-8-18(25-26-21)17-11-15-7-6-10-24-19(15)12-20(17)29;1-19(2)12-14(13-20(3,4)23-19)24(5)18-11-10-16(21-22-18)15-8-6-7-9-17(15)25/h6-12,16,27,29H,13-14H2,1-5H3;6-11,14,23,25H,12-13H2,1-5H3 |
| InChIKey | IVSFZROVEMBNOU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.99 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |