C21H32O3 — CID 15882046
methyl 2-[(2'S,4aS,8R,8aS)-2',3,4,7,8a-pentamethylspiro[1,2,4a,5-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]acetate (PubChem CID 15882046) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl 2-[(2'S,4aS,8R,8aS)-2',3,4,7,8a-pentamethylspiro[1,2,4a,5-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]acetate.
| Compound Name | methyl 2-[(2'S,4aS,8R,8aS)-2',3,4,7,8a-pentamethylspiro[1,2,4a,5-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]acetate |
|---|---|
| PubChem CID | 15882046 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl 2-[(2'S,4aS,8R,8aS)-2',3,4,7,8a-pentamethylspiro[1,2,4a,5-tetrahydronaphthalene-8,5'-oxolane]-2'-yl]acetate |
| SMILES | COC(=O)C[C@]1(C)CC[C@@]2(O1)C(C)=CC[C@H]1C(C)=C(C)CC[C@@]12C |
| InChI | InChI=1S/C21H32O3/c1-14-9-10-20(5)17(16(14)3)8-7-15(2)21(20)12-11-19(4,24-21)13-18(22)23-6/h7,17H,8-13H2,1-6H3/t17-,19-,20-,21+/m0/s1 |
| InChIKey | OCSWCZHNIBZVDP-ZIBCJSCZSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|