C6H4F2O3 — CID 158823013
2,3-difluoro-4-hydroperoxyphenol (PubChem CID 158823013) has the molecular formula C6H4F2O3 and a molecular weight of 162.09 g/mol. Its IUPAC name is 2,3-difluoro-4-hydroperoxyphenol.
| Compound Name | 2,3-difluoro-4-hydroperoxyphenol |
|---|---|
| PubChem CID | 158823013 |
| Molecular Formula | C6H4F2O3 |
| Molecular Weight | 162.09 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | 2,3-difluoro-4-hydroperoxyphenol |
| SMILES | OOc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C6H4F2O3/c7-5-3(9)1-2-4(11-10)6(5)8/h1-2,9-10H |
| InChIKey | IWCLIXDPCUEWAM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.09 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|