C9H14N2Na2O2S4 — CID 158823180
disodium;N-(3-ethoxy-3-oxopropyl)-N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate (PubChem CID 158823180) has the molecular formula C9H14N2Na2O2S4 and a molecular weight of 356.47 g/mol. Its IUPAC name is disodium;N-(3-ethoxy-3-oxopropyl)-N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate.
| Compound Name | disodium;N-(3-ethoxy-3-oxopropyl)-N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 158823180 |
| Molecular Formula | C9H14N2Na2O2S4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | disodium;N-(3-ethoxy-3-oxopropyl)-N-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate |
| SMILES | CCOC(=O)CCN(CCNC(=S)[S-])C(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C9H16N2O2S4.2Na/c1-2-13-7(12)3-5-11(9(16)17)6-4-10-8(14)15;;/h2-6H2,1H3,(H,16,17)(H2,10,14,15);;/q;2*+1/p-2 |
| InChIKey | IWCXGDFPOMYZSD-UHFFFAOYSA-L |
| XLogP | -5.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|