C36H32N4O5 — CID 158823394
ethyl 1-phenyl-3-phenylmethoxypyrazole-4-carboxylate;1-phenyl-3-phenylmethoxypyrazole-4-carbaldehyde (PubChem CID 158823394) has the molecular formula C36H32N4O5 and a molecular weight of 600.68 g/mol. Its IUPAC name is ethyl 1-phenyl-3-phenylmethoxypyrazole-4-carboxylate;1-phenyl-3-phenylmethoxypyrazole-4-carbaldehyde.
| Compound Name | ethyl 1-phenyl-3-phenylmethoxypyrazole-4-carboxylate;1-phenyl-3-phenylmethoxypyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 158823394 |
| Molecular Formula | C36H32N4O5 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | ethyl 1-phenyl-3-phenylmethoxypyrazole-4-carboxylate;1-phenyl-3-phenylmethoxypyrazole-4-carbaldehyde |
| SMILES | CCOC(=O)c1cn(-c2ccccc2)nc1OCc1ccccc1.O=Cc1cn(-c2ccccc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O3.C17H14N2O2/c1-2-23-19(22)17-13-21(16-11-7-4-8-12-16)20-18(17)24-14-15-9-5-3-6-10-15;20-12-15-11-19(16-9-5-2-6-10-16)18-17(15)21-13-14-7-3-1-4-8-14/h3-13H,2,14H2,1H3;1-12H,13H2 |
| InChIKey | IWDPMFQZMOZSQB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|