About tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate
tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate (PubChem CID 158824708) has the molecular formula C22H24N4O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate |
| PubChem CID | 158824708 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate |
| SMILES | Cc1ccc2c(c1)nc(-c1ncc(C(C#N)C(=O)OC(C)(C)C)cc1C)n2C |
| InChI | InChI=1S/C22H24N4O2/c1-13-7-8-18-17(9-13)25-20(26(18)6)19-14(2)10-15(12-24-19)16(11-23)21(27)28-22(3,4)5/h7-10,12,16H,1-6H3 |
| InChIKey | MHVSURONJVFJOQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate?
The IUPAC name of tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate (CID 158824708) is tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate.
What is the SMILES notation for tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate?
The canonical SMILES for tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate is Cc1ccc2c(c1)nc(-c1ncc(C(C#N)C(=O)OC(C)(C)C)cc1C)n2C.
What is the InChIKey of tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate?
The InChIKey is MHVSURONJVFJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O2/c1-13-7-8-18-17(9-13)25-20(26(18)6)19-14(2)10-15(12-24-19)16(11-23)21(27)28-22(3,4)5/h7-10,12,16H,1-6H3.
What are the key properties of tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate?
tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate has a molecular weight of 376.46 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyano-2-[6-(1,5-dimethylbenzimidazol-2-yl)-5-methyl-3-pyridinyl]acetate is sourced from PubChem (CID 158824708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).