C17H33N2O3P — CID 158824777
2-[[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl(methyl)phosphoryl]oxymethyl]-4,6-dimethylmorpholine (PubChem CID 158824777) has the molecular formula C17H33N2O3P and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl(methyl)phosphoryl]oxymethyl]-4,6-dimethylmorpholine.
| Compound Name | 2-[[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl(methyl)phosphoryl]oxymethyl]-4,6-dimethylmorpholine |
|---|---|
| PubChem CID | 158824777 |
| Molecular Formula | C17H33N2O3P |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-[[3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl(methyl)phosphoryl]oxymethyl]-4,6-dimethylmorpholine |
| SMILES | CC1CN(C)CC(COP(C)(=O)N2CCC3CCCCC3C2)O1 |
| InChI | InChI=1S/C17H33N2O3P/c1-14-10-18(2)12-17(22-14)13-21-23(3,20)19-9-8-15-6-4-5-7-16(15)11-19/h14-17H,4-13H2,1-3H3 |
| InChIKey | DYBNYUSRJBAADY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|