About bis(but-3-enyl)silane;dichlorosilane
bis(but-3-enyl)silane;dichlorosilane (PubChem CID 158827204) has the molecular formula C8H18Cl2Si2
and a molecular weight of 241.31 g/mol. Its IUPAC name is bis(but-3-enyl)silane;dichlorosilane.
Molecular Properties
| Compound Name | bis(but-3-enyl)silane;dichlorosilane |
| PubChem CID | 158827204 |
| Molecular Formula | C8H18Cl2Si2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | bis(but-3-enyl)silane;dichlorosilane |
| SMILES | C=CCC[SiH2]CCC=C.Cl[SiH2]Cl |
| InChI | InChI=1S/C8H16Si.Cl2H2Si/c1-3-5-7-9-8-6-4-2;1-3-2/h3-4H,1-2,5-9H2;3H2 |
| InChIKey | IWPHNJYPVZPGJR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bis(but-3-enyl)silane;dichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(but-3-enyl)silane;dichlorosilane?
The IUPAC name of bis(but-3-enyl)silane;dichlorosilane (CID 158827204) is bis(but-3-enyl)silane;dichlorosilane.
What is the SMILES notation for bis(but-3-enyl)silane;dichlorosilane?
The canonical SMILES for bis(but-3-enyl)silane;dichlorosilane is C=CCC[SiH2]CCC=C.Cl[SiH2]Cl.
What is the InChIKey of bis(but-3-enyl)silane;dichlorosilane?
The InChIKey is IWPHNJYPVZPGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Si.Cl2H2Si/c1-3-5-7-9-8-6-4-2;1-3-2/h3-4H,1-2,5-9H2;3H2.
What are the key properties of bis(but-3-enyl)silane;dichlorosilane?
bis(but-3-enyl)silane;dichlorosilane has a molecular weight of 241.31 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(but-3-enyl)silane;dichlorosilane is sourced from PubChem (CID 158827204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).