C19H19N3O2 — CID 158827780
5,6,8-trideuterio-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 158827780) has the molecular formula C19H19N3O2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 5,6,8-trideuterio-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 5,6,8-trideuterio-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158827780 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 5,6,8-trideuterio-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | [2H]c1c(C)c([2H])c2nc(C)c(C(=O)NCc3ccc4c(c3)CCO4)n2c1[2H] |
| InChI | InChI=1S/C19H19N3O2/c1-12-5-7-22-17(9-12)21-13(2)18(22)19(23)20-11-14-3-4-16-15(10-14)6-8-24-16/h3-5,7,9-10H,6,8,11H2,1-2H3,(H,20,23)/i5D,7D,9D |
| InChIKey | DQBXSMHLMVKCEV-RLJYPSSVSA-N |
| XLogP | 2.82 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |