About [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine
[[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine (PubChem CID 158828786) has the molecular formula C19H17Cl2N2OP
and a molecular weight of 391.24 g/mol. Its IUPAC name is [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine.
Molecular Properties
| Compound Name | [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine |
| PubChem CID | 158828786 |
| Molecular Formula | C19H17Cl2N2OP |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine |
| SMILES | NNP(=O)(c1ccccc1)c1ccccc1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2N2OP/c20-17-10-6-11-18(21)16(17)13-14-7-4-5-12-19(14)25(24,23-22)15-8-2-1-3-9-15/h1-12H,13,22H2,(H,23,24) |
| InChIKey | IWUCDYAEHCUVKD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine?
The IUPAC name of [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine (CID 158828786) is [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine.
What is the SMILES notation for [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine?
The canonical SMILES for [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine is NNP(=O)(c1ccccc1)c1ccccc1Cc1c(Cl)cccc1Cl.
What is the InChIKey of [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine?
The InChIKey is IWUCDYAEHCUVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N2OP/c20-17-10-6-11-18(21)16(17)13-14-7-4-5-12-19(14)25(24,23-22)15-8-2-1-3-9-15/h1-12H,13,22H2,(H,23,24).
What are the key properties of [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine?
[[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine has a molecular weight of 391.24 g/mol, XLogP of 4.28, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-[(2,6-dichlorophenyl)methyl]phenyl]-phenylphosphoryl]hydrazine is sourced from PubChem (CID 158828786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).