About 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide
3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide (PubChem CID 158828855) has the molecular formula C10H24ClN3O5S2
and a molecular weight of 365.91 g/mol. Its IUPAC name is 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide |
| PubChem CID | 158828855 |
| Molecular Formula | C10H24ClN3O5S2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCCl.NS(=O)(=O)CCCN1CCOCC1 |
| InChI | InChI=1S/C7H16N2O3S.C3H8ClNO2S/c8-13(10,11)7-1-2-9-3-5-12-6-4-9;4-2-1-3-8(5,6)7/h1-7H2,(H2,8,10,11);1-3H2,(H2,5,6,7) |
| InChIKey | IWUHOKOKBAPMSP-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide?
The IUPAC name of 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide (CID 158828855) is 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide.
What is the SMILES notation for 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide?
The canonical SMILES for 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide is NS(=O)(=O)CCCCl.NS(=O)(=O)CCCN1CCOCC1.
What is the InChIKey of 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide?
The InChIKey is IWUHOKOKBAPMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S.C3H8ClNO2S/c8-13(10,11)7-1-2-9-3-5-12-6-4-9;4-2-1-3-8(5,6)7/h1-7H2,(H2,8,10,11);1-3H2,(H2,5,6,7).
What are the key properties of 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide?
3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide has a molecular weight of 365.91 g/mol, XLogP of -1.10, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropane-1-sulfonamide;3-morpholin-4-ylpropane-1-sulfonamide is sourced from PubChem (CID 158828855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).