C16H21ClN4O2 — CID 158828990
2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethanol;2-chlorobenzene-1,4-diamine (PubChem CID 158828990) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethanol;2-chlorobenzene-1,4-diamine.
| Compound Name | 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethanol;2-chlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 158828990 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)ethanol;2-chlorobenzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(Cl)c1.Nc1ccc2c(c1)OCCN2CCO |
| InChI | InChI=1S/C10H14N2O2.C6H7ClN2/c11-8-1-2-9-10(7-8)14-6-4-12(9)3-5-13;7-5-3-4(8)1-2-6(5)9/h1-2,7,13H,3-6,11H2;1-3H,8-9H2 |
| InChIKey | IWUPSOPAVPNZLE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|