About 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol
4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol (PubChem CID 158829792) has the molecular formula C16H12F2O5
and a molecular weight of 322.26 g/mol. Its IUPAC name is 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 158829792 |
| Molecular Formula | C16H12F2O5 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol |
| SMILES | O=C1OC(=O)c2c(F)cccc21.OCc1cccc(F)c1CO |
| InChI | InChI=1S/C8H3FO3.C8H9FO2/c9-5-3-1-2-4-6(5)8(11)12-7(4)10;9-8-3-1-2-6(4-10)7(8)5-11/h1-3H;1-3,10-11H,4-5H2 |
| InChIKey | IWXATZOUVOWINA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The IUPAC name of 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol (CID 158829792) is 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol is O=C1OC(=O)c2c(F)cccc21.OCc1cccc(F)c1CO.
What is the InChIKey of 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The InChIKey is IWXATZOUVOWINA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3FO3.C8H9FO2/c9-5-3-1-2-4-6(5)8(11)12-7(4)10;9-8-3-1-2-6(4-10)7(8)5-11/h1-3H;1-3,10-11H,4-5H2.
What are the key properties of 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol has a molecular weight of 322.26 g/mol, XLogP of 1.95, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-benzofuran-1,3-dione;[3-fluoro-2-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 158829792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).