C19H34F2OSi — CID 158830969
tert-butyl-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienoxy]-dimethylsilane (PubChem CID 158830969) has the molecular formula C19H34F2OSi and a molecular weight of 344.56 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 158830969 |
| Molecular Formula | C19H34F2OSi |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | tert-butyl-[(2E,6E)-11,11-difluoro-3,7-dimethylundeca-2,6,10-trienoxy]-dimethylsilane |
| SMILES | C/C(=C\CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)CCC=C(F)F |
| InChI | InChI=1S/C19H34F2OSi/c1-16(12-9-13-18(20)21)10-8-11-17(2)14-15-22-23(6,7)19(3,4)5/h10,13-14H,8-9,11-12,15H2,1-7H3/b16-10+,17-14+ |
| InChIKey | JNJAZNCNVSGMBF-RTIZFMKRSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|