C24H29BrO11 — CID 158830997
[(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate;(1R,3R,7S,8R)-5,5-dimethyl-4,6,9,13-tetraoxatetracyclo[6.5.1.01,10.03,7]tetradec-10-en-12-one (PubChem CID 158830997) has the molecular formula C24H29BrO11 and a molecular weight of 573.39 g/mol. Its IUPAC name is [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate;(1R,3R,7S,8R)-5,5-dimethyl-4,6,9,13-tetraoxatetracyclo[6.5.1.01,10.03,7]tetradec-10-en-12-one.
| Compound Name | [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate;(1R,3R,7S,8R)-5,5-dimethyl-4,6,9,13-tetraoxatetracyclo[6.5.1.01,10.03,7]tetradec-10-en-12-one |
|---|---|
| PubChem CID | 158830997 |
| Molecular Formula | C24H29BrO11 |
| Molecular Weight | 573.39 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | [(1R,2R,6R,8S)-4,4-dimethyl-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-8-yl] 2-bromoacetate;(1R,3R,7S,8R)-5,5-dimethyl-4,6,9,13-tetraoxatetracyclo[6.5.1.01,10.03,7]tetradec-10-en-12-one |
| SMILES | CC1(C)O[C@H]2[C@H]3C[C@@](OC(=O)CBr)(C[C@H]2O1)C(=O)O3.CC1(C)O[C@H]2[C@H]3C[C@]4(C[C@H]2O1)OC(=O)C=C4O3 |
| InChI | InChI=1S/C12H15BrO6.C12H14O5/c1-11(2)17-7-4-12(18-8(14)5-13)3-6(9(7)19-11)16-10(12)15;1-11(2)15-7-5-12-4-6(10(7)17-11)14-8(12)3-9(13)16-12/h6-7,9H,3-5H2,1-2H3;3,6-7,10H,4-5H2,1-2H3/t6-,7-,9+,12-;6-,7-,10+,12-/m11/s1 |
| InChIKey | IXAUCMYJKILEFO-AQVABRJMSA-N |
| XLogP | 1.78 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|