C10H12F6N2O4 — CID 158831617
1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole-1,5-diium;bis(2,2,2-trifluoroacetate) (PubChem CID 158831617) has the molecular formula C10H12F6N2O4 and a molecular weight of 338.20 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole-1,5-diium;bis(2,2,2-trifluoroacetate).
| Compound Name | 1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole-1,5-diium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 158831617 |
| Molecular Formula | C10H12F6N2O4 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydropyrrolo[2,3-c]pyrrole-1,5-diium;bis(2,2,2-trifluoroacetate) |
| SMILES | C1=C2[NH2+]CCC2C[NH2+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H10N2.2C2HF3O2/c1-2-8-6-4-7-3-5(1)6;2*3-2(4,5)1(6)7/h4-5,7-8H,1-3H2;2*(H,6,7) |
| InChIKey | IXCPPXPRNXHXCM-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |