C13H13BF2O5 — CID 158834609
(3R)-6,7-difluoro-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 158834609) has the molecular formula C13H13BF2O5 and a molecular weight of 298.05 g/mol. Its IUPAC name is (3R)-6,7-difluoro-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-6,7-difluoro-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 158834609 |
| Molecular Formula | C13H13BF2O5 |
| Molecular Weight | 298.05 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (3R)-6,7-difluoro-2-hydroxy-3-(2-oxobutyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCC(=O)C[C@H]1Cc2cc(F)c(F)c(C(=O)O)c2OB1O |
| InChI | InChI=1S/C13H13BF2O5/c1-2-8(17)5-7-3-6-4-9(15)11(16)10(13(18)19)12(6)21-14(7)20/h4,7,20H,2-3,5H2,1H3,(H,18,19)/t7-/m1/s1 |
| InChIKey | IXLYUPSRTDHRHQ-SSDOTTSWSA-N |
| XLogP | 1.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.05 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|