C19H32F6N2O5S3 — CID 158834721
(2S)-2-[(4-acetylsulfanyl-1,1,1-trifluorobutan-2-yl)-methylamino]propanoic acid;(2S)-2-[methyl-[1,1,1-trifluoro-4-(methyldisulfanyl)butan-2-yl]amino]propanoic acid (PubChem CID 158834721) has the molecular formula C19H32F6N2O5S3 and a molecular weight of 578.66 g/mol. Its IUPAC name is (2S)-2-[(4-acetylsulfanyl-1,1,1-trifluorobutan-2-yl)-methylamino]propanoic acid;(2S)-2-[methyl-[1,1,1-trifluoro-4-(methyldisulfanyl)butan-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[(4-acetylsulfanyl-1,1,1-trifluorobutan-2-yl)-methylamino]propanoic acid;(2S)-2-[methyl-[1,1,1-trifluoro-4-(methyldisulfanyl)butan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 158834721 |
| Molecular Formula | C19H32F6N2O5S3 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (2S)-2-[(4-acetylsulfanyl-1,1,1-trifluorobutan-2-yl)-methylamino]propanoic acid;(2S)-2-[methyl-[1,1,1-trifluoro-4-(methyldisulfanyl)butan-2-yl]amino]propanoic acid |
| SMILES | CC(=O)SCCC(N(C)[C@@H](C)C(=O)O)C(F)(F)F.CSSCCC(N(C)[C@@H](C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3S.C9H16F3NO2S2/c1-6(9(16)17)14(3)8(10(11,12)13)4-5-18-7(2)15;1-6(8(14)15)13(2)7(9(10,11)12)4-5-17-16-3/h6,8H,4-5H2,1-3H3,(H,16,17);6-7H,4-5H2,1-3H3,(H,14,15)/t6-,8?;6-,7?/m00/s1 |
| InChIKey | IXMIWOLJNFQMQQ-ICZJZLCPSA-N |
| XLogP | 4.72 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|