About silver 2-hydroxyadamantane-1-carboxylate
silver 2-hydroxyadamantane-1-carboxylate (PubChem CID 158834980) has the molecular formula C11H15AgO3
and a molecular weight of 303.11 g/mol. Its IUPAC name is silver 2-hydroxyadamantane-1-carboxylate.
Molecular Properties
| Compound Name | silver 2-hydroxyadamantane-1-carboxylate |
| PubChem CID | 158834980 |
| Molecular Formula | C11H15AgO3 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | silver 2-hydroxyadamantane-1-carboxylate |
| SMILES | O=C([O-])C12CC3CC(CC(C3)C1O)C2.[Ag+] |
| InChI | InChI=1S/C11H16O3.Ag/c12-9-8-2-6-1-7(3-8)5-11(9,4-6)10(13)14;/h6-9,12H,1-5H2,(H,13,14);/q;+1/p-1 |
| InChIKey | IXNDKSPFDZHVRK-UHFFFAOYSA-M |
| XLogP | -0.08 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze silver 2-hydroxyadamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 2-hydroxyadamantane-1-carboxylate?
The IUPAC name of silver 2-hydroxyadamantane-1-carboxylate (CID 158834980) is silver 2-hydroxyadamantane-1-carboxylate.
What is the SMILES notation for silver 2-hydroxyadamantane-1-carboxylate?
The canonical SMILES for silver 2-hydroxyadamantane-1-carboxylate is O=C([O-])C12CC3CC(CC(C3)C1O)C2.[Ag+].
What is the InChIKey of silver 2-hydroxyadamantane-1-carboxylate?
The InChIKey is IXNDKSPFDZHVRK-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16O3.Ag/c12-9-8-2-6-1-7(3-8)5-11(9,4-6)10(13)14;/h6-9,12H,1-5H2,(H,13,14);/q;+1/p-1.
What are the key properties of silver 2-hydroxyadamantane-1-carboxylate?
silver 2-hydroxyadamantane-1-carboxylate has a molecular weight of 303.11 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 2-hydroxyadamantane-1-carboxylate is sourced from PubChem (CID 158834980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).