C30H57N9 — CID 15883572
2-N,4-N,6-N-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 15883572) has the molecular formula C30H57N9 and a molecular weight of 543.85 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 15883572 |
| Molecular Formula | C30H57N9 |
| Molecular Weight | 543.85 g/mol |
| Exact Mass | 543.47 |
| IUPAC Name | 2-N,4-N,6-N-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1(C)CC(Nc2nc(NC3CC(C)(C)NC(C)(C)C3)nc(NC3CC(C)(C)NC(C)(C)C3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H57N9/c1-25(2)13-19(14-26(3,4)37-25)31-22-34-23(32-20-15-27(5,6)38-28(7,8)16-20)36-24(35-22)33-21-17-29(9,10)39-30(11,12)18-21/h19-21,37-39H,13-18H2,1-12H3,(H3,31,32,33,34,35,36) |
| InChIKey | RLXPEQVECSTYJT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |