C42H69NO40P2-4 — CID 158835804
CID 158835804 (PubChem CID 158835804) has the molecular formula C42H69NO40P2-4 and a molecular weight of 1289.93 g/mol.
| Compound Name | CID 158835804 |
|---|---|
| PubChem CID | 158835804 |
| Molecular Formula | C42H69NO40P2-4 |
| Molecular Weight | 1289.93 g/mol |
| Exact Mass | 1289.29 |
| IUPAC Name | — |
| SMILES | COCC(=O)CNC(=O)CO[C@@H]1OC(CO[C@H]2OC(CO[C@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OC(CO[O-])[C@@H](O)[C@H](O)C3O)[C@@H](O)[C@H](O)C2O)[C@@H](O)[C@H](O[C@H]2OC(CO)[C@@H](O)[C@H](O)C2O[C@H]2OC(COP(=O)([O-])[O-])[C@@H](O)[C@H](O)C2O)C1O.O=P[O-] |
| InChI | InChI=1S/C42H72NO38P.HO2P/c1-67-5-11(46)2-43-18(47)10-70-38-33(62)34(79-42-36(29(58)20(49)13(4-45)74-42)81-40-32(61)27(56)23(52)17(78-40)9-72-82(64,65)66)24(53)15(76-38)7-68-37-30(59)25(54)21(50)14(75-37)6-69-41-35(28(57)19(48)12(3-44)73-41)80-39-31(60)26(55)22(51)16(77-39)8-71-63;1-3-2/h12-17,19-42,44-45,48-63H,2-10H2,1H3,(H,43,47)(H2,64,65,66);(H,1,2)/p-4/t12?,13?,14?,15?,16?,17?,19-,20-,21-,22-,23-,24-,25+,26+,27+,28+,29+,30?,31?,32?,33?,34+,35?,36?,37+,38-,39+,40-,41+,42-;/m1./s1 |
| InChIKey | IXPUDCYWVLIRLM-DCMSJFIHSA-J |
| XLogP | -17.04 |
| TPSA | 654.91 Ų |
| H-Bond Donors | 18 |
| H-Bond Acceptors | 40 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1289.93 |
| LogP ≤ 5 | -17.04 |
| H-Bond Donors ≤ 5 | 18 |
| H-Bond Acceptors ≤ 10 | 40 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|