C26H35NO6S — CID 158838101
[(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-(4-aminophenyl)sulfanyl-3-oxobutanoate (PubChem CID 158838101) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-(4-aminophenyl)sulfanyl-3-oxobutanoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-(4-aminophenyl)sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 158838101 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 4-(4-aminophenyl)sulfanyl-3-oxobutanoate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CC(=O)CSc2ccc(N)cc2)CC[C@]2(CO2)[C@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C26H35NO6S/c1-16(2)5-10-21-25(3,33-21)24-23(30-4)20(11-12-26(24)15-31-26)32-22(29)13-18(28)14-34-19-8-6-17(27)7-9-19/h5-9,20-21,23-24H,10-15,27H2,1-4H3/t20-,21-,23-,24-,25-,26+/m1/s1 |
| InChIKey | CKEUZKUKNLHVCJ-ZKBIWYDVSA-N |
| XLogP | 3.94 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|