About carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate
carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate (PubChem CID 158838234) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate |
| PubChem CID | 158838234 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate |
| SMILES | C=CCCCOC(=O)N1CCCC1=O.O=C=O |
| InChI | InChI=1S/C10H15NO3.CO2/c1-2-3-4-8-14-10(13)11-7-5-6-9(11)12;2-1-3/h2H,1,3-8H2; |
| InChIKey | IXXDWUYPMPNEFE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate?
The IUPAC name of carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate (CID 158838234) is carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate?
The canonical SMILES for carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate is C=CCCCOC(=O)N1CCCC1=O.O=C=O.
What is the InChIKey of carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate?
The InChIKey is IXXDWUYPMPNEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3.CO2/c1-2-3-4-8-14-10(13)11-7-5-6-9(11)12;2-1-3/h2H,1,3-8H2;.
What are the key properties of carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate?
carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate has a molecular weight of 241.24 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;pent-4-enyl 2-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 158838234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).