C43H42N4O4 — CID 158838728
2-[1-[[2-(benzylamino)phenyl]methyl]indol-3-yl]acetic acid;ethyl 2-[1-[(2-aminophenyl)methyl]indol-3-yl]acetate (PubChem CID 158838728) has the molecular formula C43H42N4O4 and a molecular weight of 678.83 g/mol. Its IUPAC name is 2-[1-[[2-(benzylamino)phenyl]methyl]indol-3-yl]acetic acid;ethyl 2-[1-[(2-aminophenyl)methyl]indol-3-yl]acetate.
| Compound Name | 2-[1-[[2-(benzylamino)phenyl]methyl]indol-3-yl]acetic acid;ethyl 2-[1-[(2-aminophenyl)methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 158838728 |
| Molecular Formula | C43H42N4O4 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | 2-[1-[[2-(benzylamino)phenyl]methyl]indol-3-yl]acetic acid;ethyl 2-[1-[(2-aminophenyl)methyl]indol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cn(Cc2ccccc2N)c2ccccc12.O=C(O)Cc1cn(Cc2ccccc2NCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C24H22N2O2.C19H20N2O2/c27-24(28)14-20-17-26(23-13-7-5-11-21(20)23)16-19-10-4-6-12-22(19)25-15-18-8-2-1-3-9-18;1-2-23-19(22)11-15-13-21(18-10-6-4-8-16(15)18)12-14-7-3-5-9-17(14)20/h1-13,17,25H,14-16H2,(H,27,28);3-10,13H,2,11-12,20H2,1H3 |
| InChIKey | IXYSGTVHUXXTLK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|