About [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane
[dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane (PubChem CID 158839981) has the molecular formula C7H22Cl3NSi3
and a molecular weight of 310.88 g/mol. Its IUPAC name is [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane.
Molecular Properties
| Compound Name | [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane |
| PubChem CID | 158839981 |
| Molecular Formula | C7H22Cl3NSi3 |
| Molecular Weight | 310.88 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane |
| SMILES | C[Si](C)(C)N[Si](C)(C)C.C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H19NSi2.CH3Cl3Si/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1H3 |
| InChIKey | IYCQJHJUTRUAKU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane?
The IUPAC name of [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane (CID 158839981) is [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane.
What is the SMILES notation for [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane?
The canonical SMILES for [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane is C[Si](C)(C)N[Si](C)(C)C.C[Si](Cl)(Cl)Cl.
What is the InChIKey of [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane?
The InChIKey is IYCQJHJUTRUAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.CH3Cl3Si/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1H3.
What are the key properties of [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane?
[dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane has a molecular weight of 310.88 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-(trimethylsilylamino)silyl]methane;trichloro(methyl)silane is sourced from PubChem (CID 158839981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).