About 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline
4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline (PubChem CID 158841519) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline.
Molecular Properties
| Compound Name | 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline |
| PubChem CID | 158841519 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline |
| SMILES | Nc1ccc(C2=CCC(N)(C3CCNCC3)C=C2)cc1 |
| InChI | InChI=1S/C17H23N3/c18-16-3-1-13(2-4-16)14-5-9-17(19,10-6-14)15-7-11-20-12-8-15/h1-6,9,15,20H,7-8,10-12,18-19H2 |
| InChIKey | IYHNMJSGQFOYEC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The IUPAC name of 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline (CID 158841519) is 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline.
What is the SMILES notation for 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The canonical SMILES for 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline is Nc1ccc(C2=CCC(N)(C3CCNCC3)C=C2)cc1.
What is the InChIKey of 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
The InChIKey is IYHNMJSGQFOYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c18-16-3-1-13(2-4-16)14-5-9-17(19,10-6-14)15-7-11-20-12-8-15/h1-6,9,15,20H,7-8,10-12,18-19H2.
What are the key properties of 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline?
4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline has a molecular weight of 269.39 g/mol, XLogP of 2.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-4-piperidin-4-ylcyclohexa-1,5-dien-1-yl)aniline is sourced from PubChem (CID 158841519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).