About 1,3-dimethyl-4,5-dihydro-2H-indene
1,3-dimethyl-4,5-dihydro-2H-indene (PubChem CID 158841865) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-dihydro-2H-indene.
Molecular Properties
| Compound Name | 1,3-dimethyl-4,5-dihydro-2H-indene |
| PubChem CID | 158841865 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1,3-dimethyl-4,5-dihydro-2H-indene |
| SMILES | CC1=C2C=CCCC2=C(C)C1 |
| InChI | InChI=1S/C11H14/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3,5H,4,6-7H2,1-2H3 |
| InChIKey | LGWVZTBFURTZKG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dimethyl-4,5-dihydro-2H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5-dihydro-2H-indene?
The IUPAC name of 1,3-dimethyl-4,5-dihydro-2H-indene (CID 158841865) is 1,3-dimethyl-4,5-dihydro-2H-indene.
What is the SMILES notation for 1,3-dimethyl-4,5-dihydro-2H-indene?
The canonical SMILES for 1,3-dimethyl-4,5-dihydro-2H-indene is CC1=C2C=CCCC2=C(C)C1.
What is the InChIKey of 1,3-dimethyl-4,5-dihydro-2H-indene?
The InChIKey is LGWVZTBFURTZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3,5H,4,6-7H2,1-2H3.
What are the key properties of 1,3-dimethyl-4,5-dihydro-2H-indene?
1,3-dimethyl-4,5-dihydro-2H-indene has a molecular weight of 146.23 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5-dihydro-2H-indene is sourced from PubChem (CID 158841865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).