C28H31BrO6S2 — CID 158842081
2-bromo-3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene;3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene (PubChem CID 158842081) has the molecular formula C28H31BrO6S2 and a molecular weight of 607.59 g/mol. Its IUPAC name is 2-bromo-3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene;3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene.
| Compound Name | 2-bromo-3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene;3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 158842081 |
| Molecular Formula | C28H31BrO6S2 |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | 2-bromo-3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene;3-(ethoxymethoxy)-4-(2-methoxyphenyl)thiophene |
| SMILES | CCOCOc1c(-c2ccccc2OC)csc1Br.CCOCOc1cscc1-c1ccccc1OC |
| InChI | InChI=1S/C14H15BrO3S.C14H16O3S/c1-3-17-9-18-13-11(8-19-14(13)15)10-6-4-5-7-12(10)16-2;1-3-16-10-17-14-9-18-8-12(14)11-6-4-5-7-13(11)15-2/h4-8H,3,9H2,1-2H3;4-9H,3,10H2,1-2H3 |
| InChIKey | IYJFNFOHFRDACB-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|