C21H18ClN3O2 — CID 158842499
2-(2-chlorophenyl)-4-(3-ethylphenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 158842499) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(3-ethylphenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(2-chlorophenyl)-4-(3-ethylphenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 158842499 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(3-ethylphenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | CCc1cccc(-c2c3c(=O)n(-c4ccccc4Cl)[nH]c3cc(=O)n2C)c1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-3-13-7-6-8-14(11-13)20-19-16(12-18(26)24(20)2)23-25(21(19)27)17-10-5-4-9-15(17)22/h4-12,23H,3H2,1-2H3 |
| InChIKey | IYKPIFSQPHBBIB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|