About N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride
N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride (PubChem CID 15884328) has the molecular formula C8H18ClN3
and a molecular weight of 191.71 g/mol. Its IUPAC name is N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride.
Molecular Properties
| Compound Name | N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride |
| PubChem CID | 15884328 |
| Molecular Formula | C8H18ClN3 |
| Molecular Weight | 191.71 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride |
| SMILES | CCNC1=NCCC[N+]1(C)C.[Cl-] |
| InChI | InChI=1S/C8H18N3.ClH/c1-4-9-8-10-6-5-7-11(8,2)3;/h4-7H2,1-3H3,(H,9,10);1H/q+1;/p-1 |
| InChIKey | JGOOQFBVYPOANM-UHFFFAOYSA-M |
| XLogP | -2.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.71 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride?
The IUPAC name of N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride (CID 15884328) is N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride.
What is the SMILES notation for N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride?
The canonical SMILES for N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride is CCNC1=NCCC[N+]1(C)C.[Cl-].
What is the InChIKey of N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride?
The InChIKey is JGOOQFBVYPOANM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N3.ClH/c1-4-9-8-10-6-5-7-11(8,2)3;/h4-7H2,1-3H3,(H,9,10);1H/q+1;/p-1.
What are the key properties of N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride?
N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride has a molecular weight of 191.71 g/mol, XLogP of -2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-amine chloride is sourced from PubChem (CID 15884328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).