About 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde
2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde (PubChem CID 158843350) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde.
Molecular Properties
| Compound Name | 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde |
| PubChem CID | 158843350 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde |
| SMILES | CCCOC1=CCCC(OCC=O)=C1 |
| InChI | InChI=1S/C11H16O3/c1-2-7-13-10-4-3-5-11(9-10)14-8-6-12/h4,6,9H,2-3,5,7-8H2,1H3 |
| InChIKey | FZWREOVHHYPVHW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The IUPAC name of 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde (CID 158843350) is 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde.
What is the SMILES notation for 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The canonical SMILES for 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde is CCCOC1=CCCC(OCC=O)=C1.
What is the InChIKey of 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
The InChIKey is FZWREOVHHYPVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-7-13-10-4-3-5-11(9-10)14-8-6-12/h4,6,9H,2-3,5,7-8H2,1H3.
What are the key properties of 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde?
2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde has a molecular weight of 196.25 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propoxycyclohexa-1,3-dien-1-yl)oxyacetaldehyde is sourced from PubChem (CID 158843350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).