C22H20N2O4 — CID 158843653
1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one;1H-quinolin-2-one (PubChem CID 158843653) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one;1H-quinolin-2-one.
| Compound Name | 1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one;1H-quinolin-2-one |
|---|---|
| PubChem CID | 158843653 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-(1,3-dioxolan-2-ylmethyl)quinolin-2-one;1H-quinolin-2-one |
| SMILES | O=c1ccc2ccccc2[nH]1.O=c1ccc2ccccc2n1CC1OCCO1 |
| InChI | InChI=1S/C13H13NO3.C9H7NO/c15-12-6-5-10-3-1-2-4-11(10)14(12)9-13-16-7-8-17-13;11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6,13H,7-9H2;1-6H,(H,10,11) |
| InChIKey | IYODVWKNQAERCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |