About bis(1-methylpiperazine);urea
bis(1-methylpiperazine);urea (PubChem CID 158844048) has the molecular formula C11H28N6O
and a molecular weight of 260.39 g/mol. Its IUPAC name is bis(1-methylpiperazine);urea.
Molecular Properties
| Compound Name | bis(1-methylpiperazine);urea |
| PubChem CID | 158844048 |
| Molecular Formula | C11H28N6O |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | bis(1-methylpiperazine);urea |
| SMILES | CN1CCNCC1.CN1CCNCC1.NC(N)=O |
| InChI | InChI=1S/2C5H12N2.CH4N2O/c2*1-7-4-2-6-3-5-7;2-1(3)4/h2*6H,2-5H2,1H3;(H4,2,3,4) |
| InChIKey | IYPHCNPSJJJTLA-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1-methylpiperazine);urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methylpiperazine);urea?
The IUPAC name of bis(1-methylpiperazine);urea (CID 158844048) is bis(1-methylpiperazine);urea.
What is the SMILES notation for bis(1-methylpiperazine);urea?
The canonical SMILES for bis(1-methylpiperazine);urea is CN1CCNCC1.CN1CCNCC1.NC(N)=O.
What is the InChIKey of bis(1-methylpiperazine);urea?
The InChIKey is IYPHCNPSJJJTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12N2.CH4N2O/c2*1-7-4-2-6-3-5-7;2-1(3)4/h2*6H,2-5H2,1H3;(H4,2,3,4).
What are the key properties of bis(1-methylpiperazine);urea?
bis(1-methylpiperazine);urea has a molecular weight of 260.39 g/mol, XLogP of -1.93, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methylpiperazine);urea is sourced from PubChem (CID 158844048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).