About lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine
lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine (PubChem CID 15884419) has the molecular formula C14H18ILiN2
and a molecular weight of 348.16 g/mol. Its IUPAC name is lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine |
| PubChem CID | 15884419 |
| Molecular Formula | C14H18ILiN2 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine |
| SMILES | [C-]#Cc1cc(CN(C)C)c(I)c(CN(C)C)c1.[Li+] |
| InChI | InChI=1S/C14H18IN2.Li/c1-6-11-7-12(9-16(2)3)14(15)13(8-11)10-17(4)5;/h7-8H,9-10H2,2-5H3;/q-1;+1 |
| InChIKey | WFFCNTNWNWIRTC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine?
The IUPAC name of lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine (CID 15884419) is lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine?
The canonical SMILES for lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine is [C-]#Cc1cc(CN(C)C)c(I)c(CN(C)C)c1.[Li+].
What is the InChIKey of lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine?
The InChIKey is WFFCNTNWNWIRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18IN2.Li/c1-6-11-7-12(9-16(2)3)14(15)13(8-11)10-17(4)5;/h7-8H,9-10H2,2-5H3;/q-1;+1.
What are the key properties of lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine?
lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine has a molecular weight of 348.16 g/mol, XLogP of -0.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-[3-[(dimethylamino)methyl]-5-ethynyl-2-iodophenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 15884419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).