C22H13N — CID 158844196
17-isocyanopentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),2(10),3,5(9),7,11,13,15(20),16,18-decaene (PubChem CID 158844196) has the molecular formula C22H13N and a molecular weight of 291.35 g/mol. Its IUPAC name is 17-isocyanopentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),2(10),3,5(9),7,11,13,15(20),16,18-decaene.
| Compound Name | 17-isocyanopentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),2(10),3,5(9),7,11,13,15(20),16,18-decaene |
|---|---|
| PubChem CID | 158844196 |
| Molecular Formula | C22H13N |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 17-isocyanopentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(21),2(10),3,5(9),7,11,13,15(20),16,18-decaene |
| SMILES | [C-]#[N+]c1ccc2cc3c(ccc4c5c(ccc43)CC=C5)cc2c1 |
| InChI | InChI=1S/C22H13N/c1-23-18-8-5-15-13-22-16(11-17(15)12-18)7-10-20-19-4-2-3-14(19)6-9-21(20)22/h2,4-13H,3H2 |
| InChIKey | AXYIAMMZPSCGTN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|