About tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane
tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane (PubChem CID 158844470) has the molecular formula C33H33N2O3P
and a molecular weight of 536.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane |
| PubChem CID | 158844470 |
| Molecular Formula | C33H33N2O3P |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)n1cnc2ccccc2c1=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C15H18N2O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(14(19)20-15(2,3)4)17-9-16-12-8-6-5-7-11(12)13(17)18/h1-15H;5-10H,1-4H3/t;10-/m.0/s1 |
| InChIKey | IYQMZZAJTSUKPN-CICJTZRQSA-N |
| XLogP | 5.74 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane?
The IUPAC name of tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane (CID 158844470) is tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane.
What is the SMILES notation for tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane?
The canonical SMILES for tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane is C[C@@H](C(=O)OC(C)(C)C)n1cnc2ccccc2c1=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane?
The InChIKey is IYQMZZAJTSUKPN-CICJTZRQSA-N. The full InChI is InChI=1S/C18H15P.C15H18N2O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(14(19)20-15(2,3)4)17-9-16-12-8-6-5-7-11(12)13(17)18/h1-15H;5-10H,1-4H3/t;10-/m.0/s1.
What are the key properties of tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane?
tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane has a molecular weight of 536.61 g/mol, XLogP of 5.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(4-oxoquinazolin-3-yl)propanoate;triphenylphosphane is sourced from PubChem (CID 158844470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).