C20H17ClN2O3 — CID 158844615
1-chloro-6-methoxyisoquinoline;6-methoxy-2H-isoquinolin-1-one (PubChem CID 158844615) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 1-chloro-6-methoxyisoquinoline;6-methoxy-2H-isoquinolin-1-one.
| Compound Name | 1-chloro-6-methoxyisoquinoline;6-methoxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 158844615 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-chloro-6-methoxyisoquinoline;6-methoxy-2H-isoquinolin-1-one |
| SMILES | COc1ccc2c(=O)[nH]ccc2c1.COc1ccc2c(Cl)nccc2c1 |
| InChI | InChI=1S/C10H8ClNO.C10H9NO2/c1-13-8-2-3-9-7(6-8)4-5-12-10(9)11;1-13-8-2-3-9-7(6-8)4-5-11-10(9)12/h2-6H,1H3;2-6H,1H3,(H,11,12) |
| InChIKey | IYQYFXWKQCWMLF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|