About 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol
4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol (PubChem CID 158845060) has the molecular formula C10H20O4S
and a molecular weight of 236.33 g/mol. Its IUPAC name is 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol |
| PubChem CID | 158845060 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol |
| SMILES | C=CCS.CCCC1(OC)CCOOO1 |
| InChI | InChI=1S/C7H14O4.C3H6S/c1-3-4-7(8-2)5-6-9-11-10-7;1-2-3-4/h3-6H2,1-2H3;2,4H,1,3H2 |
| InChIKey | IYSIRYNVEMBGNM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol?
The IUPAC name of 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol (CID 158845060) is 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol.
What is the SMILES notation for 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol?
The canonical SMILES for 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol is C=CCS.CCCC1(OC)CCOOO1.
What is the InChIKey of 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol?
The InChIKey is IYSIRYNVEMBGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4.C3H6S/c1-3-4-7(8-2)5-6-9-11-10-7;1-2-3-4/h3-6H2,1-2H3;2,4H,1,3H2.
What are the key properties of 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol?
4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol has a molecular weight of 236.33 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-4-propyltrioxane;prop-2-ene-1-thiol is sourced from PubChem (CID 158845060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).