C15H26O2 — CID 15884560
(1S,4R,4aS,8S,8aR)-8-hydroperoxy-4-methyl-7-methylidene-1-propan-2-yl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene (PubChem CID 15884560) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1S,4R,4aS,8S,8aR)-8-hydroperoxy-4-methyl-7-methylidene-1-propan-2-yl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene.
| Compound Name | (1S,4R,4aS,8S,8aR)-8-hydroperoxy-4-methyl-7-methylidene-1-propan-2-yl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 15884560 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1S,4R,4aS,8S,8aR)-8-hydroperoxy-4-methyl-7-methylidene-1-propan-2-yl-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene |
| SMILES | C=C1CC[C@@H]2[C@H]([C@@H]1OO)[C@H](C(C)C)CC[C@H]2C |
| InChI | InChI=1S/C15H26O2/c1-9(2)12-7-5-10(3)13-8-6-11(4)15(17-16)14(12)13/h9-10,12-16H,4-8H2,1-3H3/t10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | HDFKBEJRIMMBTN-BGNCJLHMSA-N |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|