C28H32N2O4 — CID 158846300
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-7-[2-[2-(ethylideneamino)ethoxy]ethoxy]heptane-1,5-dione (PubChem CID 158846300) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-7-[2-[2-(ethylideneamino)ethoxy]ethoxy]heptane-1,5-dione.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-7-[2-[2-(ethylideneamino)ethoxy]ethoxy]heptane-1,5-dione |
|---|---|
| PubChem CID | 158846300 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-7-[2-[2-(ethylideneamino)ethoxy]ethoxy]heptane-1,5-dione |
| SMILES | C/C=N/CCOCCOCCC(=O)CCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C28H32N2O4/c1-2-29-17-19-34-21-20-33-18-16-26(31)11-7-13-28(32)30-22-25-10-4-3-8-23(25)14-15-24-9-5-6-12-27(24)30/h2-6,8-10,12H,7,11,13,16-22H2,1H3/b29-2+ |
| InChIKey | IYWMTDWRAARTGV-APYCDXNCSA-N |
| XLogP | 4.19 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|