C41H30Cl2N6O6 — CID 158848053
3-(2-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;2-(1H-indol-3-yl)acetamide;methyl 2-(2-chloro-1H-indol-3-yl)-2-oxoacetate (PubChem CID 158848053) has the molecular formula C41H30Cl2N6O6 and a molecular weight of 773.63 g/mol. Its IUPAC name is 3-(2-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;2-(1H-indol-3-yl)acetamide;methyl 2-(2-chloro-1H-indol-3-yl)-2-oxoacetate.
| Compound Name | 3-(2-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;2-(1H-indol-3-yl)acetamide;methyl 2-(2-chloro-1H-indol-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 158848053 |
| Molecular Formula | C41H30Cl2N6O6 |
| Molecular Weight | 773.63 g/mol |
| Exact Mass | 772.16 |
| IUPAC Name | 3-(2-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;2-(1H-indol-3-yl)acetamide;methyl 2-(2-chloro-1H-indol-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c(Cl)[nH]c2ccccc12.NC(=O)Cc1c[nH]c2ccccc12.O=C1NC(=O)C(c2c(Cl)[nH]c3ccccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H12ClN3O2.C11H8ClNO3.C10H10N2O/c21-18-15(11-6-2-4-8-14(11)23-18)17-16(19(25)24-20(17)26)12-9-22-13-7-3-1-5-10(12)13;1-16-11(15)9(14)8-6-4-2-3-5-7(6)13-10(8)12;11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-9,22-23H,(H,24,25,26);2-5,13H,1H3;1-4,6,12H,5H2,(H2,11,13) |
| InChIKey | IZCAHZJOZXYVHF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 195.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.63 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|