C29H30F5N3O2 — CID 158848496
1-[(2S,4R)-4-[2-(1,1-difluoroethoxy)anilino]-2-methyl-6-[3-(3,3,3-trifluoropropylamino)phenyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 158848496) has the molecular formula C29H30F5N3O2 and a molecular weight of 547.57 g/mol. Its IUPAC name is 1-[(2S,4R)-4-[2-(1,1-difluoroethoxy)anilino]-2-methyl-6-[3-(3,3,3-trifluoropropylamino)phenyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-[2-(1,1-difluoroethoxy)anilino]-2-methyl-6-[3-(3,3,3-trifluoropropylamino)phenyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 158848496 |
| Molecular Formula | C29H30F5N3O2 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 1-[(2S,4R)-4-[2-(1,1-difluoroethoxy)anilino]-2-methyl-6-[3-(3,3,3-trifluoropropylamino)phenyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(-c3cccc(NCCC(F)(F)F)c3)cc2[C@H](Nc2ccccc2OC(C)(F)F)C[C@@H]1C |
| InChI | InChI=1S/C29H30F5N3O2/c1-18-15-25(36-24-9-4-5-10-27(24)39-28(3,30)31)23-17-21(11-12-26(23)37(18)19(2)38)20-7-6-8-22(16-20)35-14-13-29(32,33)34/h4-12,16-18,25,35-36H,13-15H2,1-3H3/t18-,25+/m0/s1 |
| InChIKey | ZLKGPHOFNWONAY-AVRWGWEMSA-N |
| XLogP | 8.01 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |