About 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane
2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane (PubChem CID 158851357) has the molecular formula C18H38O
and a molecular weight of 270.50 g/mol. Its IUPAC name is 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane.
Molecular Properties
| Compound Name | 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane |
| PubChem CID | 158851357 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane |
| SMILES | C=CCC(C)C.CC(C)CC1CO1.CCCC(C)C |
| InChI | InChI=1S/C6H12O.C6H14.C6H12/c1-5(2)3-6-4-7-6;2*1-4-5-6(2)3/h5-6H,3-4H2,1-2H3;6H,4-5H2,1-3H3;4,6H,1,5H2,2-3H3 |
| InChIKey | IZMJOONIONEURQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane?
The IUPAC name of 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane (CID 158851357) is 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane.
What is the SMILES notation for 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane?
The canonical SMILES for 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane is C=CCC(C)C.CC(C)CC1CO1.CCCC(C)C.
What is the InChIKey of 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane?
The InChIKey is IZMJOONIONEURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C6H14.C6H12/c1-5(2)3-6-4-7-6;2*1-4-5-6(2)3/h5-6H,3-4H2,1-2H3;6H,4-5H2,1-3H3;4,6H,1,5H2,2-3H3.
What are the key properties of 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane?
2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane has a molecular weight of 270.50 g/mol, XLogP of 6.09, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane;4-methylpent-1-ene;2-(2-methylpropyl)oxirane is sourced from PubChem (CID 158851357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).