C7H17N3O4S — CID 158851569
N,N-dimethylformamide;piperazine-1-sulfonic acid (PubChem CID 158851569) has the molecular formula C7H17N3O4S and a molecular weight of 239.30 g/mol. Its IUPAC name is N,N-dimethylformamide;piperazine-1-sulfonic acid.
| Compound Name | N,N-dimethylformamide;piperazine-1-sulfonic acid |
|---|---|
| PubChem CID | 158851569 |
| Molecular Formula | C7H17N3O4S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N,N-dimethylformamide;piperazine-1-sulfonic acid |
| SMILES | CN(C)C=O.O=S(=O)(O)N1CCNCC1 |
| InChI | InChI=1S/C4H10N2O3S.C3H7NO/c7-10(8,9)6-3-1-5-2-4-6;1-4(2)3-5/h5H,1-4H2,(H,7,8,9);3H,1-2H3 |
| InChIKey | IZNBRTPJECIWJA-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|