About 7-bromo-1-butyl-3,4-dihydroisoquinoline
7-bromo-1-butyl-3,4-dihydroisoquinoline (PubChem CID 15885180) has the molecular formula C13H16BrN
and a molecular weight of 266.18 g/mol. Its IUPAC name is 7-bromo-1-butyl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 7-bromo-1-butyl-3,4-dihydroisoquinoline |
| PubChem CID | 15885180 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 7-bromo-1-butyl-3,4-dihydroisoquinoline |
| SMILES | CCCCC1=NCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H16BrN/c1-2-3-4-13-12-9-11(14)6-5-10(12)7-8-15-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | QRLLXCDUSAQKTI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1-butyl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-butyl-3,4-dihydroisoquinoline?
The IUPAC name of 7-bromo-1-butyl-3,4-dihydroisoquinoline (CID 15885180) is 7-bromo-1-butyl-3,4-dihydroisoquinoline.
What is the SMILES notation for 7-bromo-1-butyl-3,4-dihydroisoquinoline?
The canonical SMILES for 7-bromo-1-butyl-3,4-dihydroisoquinoline is CCCCC1=NCCc2ccc(Br)cc21.
What is the InChIKey of 7-bromo-1-butyl-3,4-dihydroisoquinoline?
The InChIKey is QRLLXCDUSAQKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN/c1-2-3-4-13-12-9-11(14)6-5-10(12)7-8-15-13/h5-6,9H,2-4,7-8H2,1H3.
What are the key properties of 7-bromo-1-butyl-3,4-dihydroisoquinoline?
7-bromo-1-butyl-3,4-dihydroisoquinoline has a molecular weight of 266.18 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-butyl-3,4-dihydroisoquinoline is sourced from PubChem (CID 15885180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).