C9H10BrN — CID 15885183
6-bromo-1,2,3,4-tetrahydroisoquinoline (PubChem CID 15885183) has the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. Its IUPAC name is 6-bromo-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-bromo-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 15885183 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 6-bromo-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Brc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H10BrN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-2,5,11H,3-4,6H2 |
| InChIKey | URDGCPQHZSDBRG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |